C18H28N2O2 — CID 101001615
(2S,5S)-2-hexyl-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one (PubChem CID 101001615) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2S,5S)-2-hexyl-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one.
| Compound Name | (2S,5S)-2-hexyl-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
|---|---|
| PubChem CID | 101001615 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2S,5S)-2-hexyl-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
| SMILES | CCCCCC[C@H]1C(=O)N[C@H](CO)Cc2ccccc2N1C |
| InChI | InChI=1S/C18H28N2O2/c1-3-4-5-6-11-17-18(22)19-15(13-21)12-14-9-7-8-10-16(14)20(17)2/h7-10,15,17,21H,3-6,11-13H2,1-2H3,(H,19,22)/t15-,17-/m0/s1 |
| InChIKey | DHMPERBZMUHYSD-RDJZCZTQSA-N |
| XLogP | 2.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|