C15H14N2O2 — CID 101007820
[(2E)-penta-2,4-dienyl] (E)-2-diazo-4-phenylbut-3-enoate (PubChem CID 101007820) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is [(2E)-penta-2,4-dienyl] (E)-2-diazo-4-phenylbut-3-enoate.
| Compound Name | [(2E)-penta-2,4-dienyl] (E)-2-diazo-4-phenylbut-3-enoate |
|---|---|
| PubChem CID | 101007820 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | [(2E)-penta-2,4-dienyl] (E)-2-diazo-4-phenylbut-3-enoate |
| SMILES | C=C/C=C/COC(=O)C(/C=C/c1ccccc1)=[N+]=[N-] |
| InChI | InChI=1S/C15H14N2O2/c1-2-3-7-12-19-15(18)14(17-16)11-10-13-8-5-4-6-9-13/h2-11H,1,12H2/b7-3+,11-10+ |
| InChIKey | FWPZEOJVBXXJRF-LRPGZYIXSA-N |
| XLogP | 2.66 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|