C11H19NO5 — CID 101014290
(4S)-4-[(1R)-1-[(E)-but-2-enoxy]-2-nitroethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 101014290) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is (4S)-4-[(1R)-1-[(E)-but-2-enoxy]-2-nitroethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(1R)-1-[(E)-but-2-enoxy]-2-nitroethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 101014290 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (4S)-4-[(1R)-1-[(E)-but-2-enoxy]-2-nitroethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C/C=C/CO[C@H](C[N+](=O)[O-])[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H19NO5/c1-4-5-6-15-9(7-12(13)14)10-8-16-11(2,3)17-10/h4-5,9-10H,6-8H2,1-3H3/b5-4+/t9-,10+/m1/s1 |
| InChIKey | CURQPKIBVYMMFV-CFUOYWMPSA-N |
| XLogP | 1.38 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|