C17H15NO3 — CID 101020623
(4,7-dimethyl-2-oxo-1,3-dihydroindol-3-yl) benzoate (PubChem CID 101020623) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (4,7-dimethyl-2-oxo-1,3-dihydroindol-3-yl) benzoate.
| Compound Name | (4,7-dimethyl-2-oxo-1,3-dihydroindol-3-yl) benzoate |
|---|---|
| PubChem CID | 101020623 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (4,7-dimethyl-2-oxo-1,3-dihydroindol-3-yl) benzoate |
| SMILES | Cc1ccc(C)c2c1NC(=O)C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15NO3/c1-10-8-9-11(2)14-13(10)15(16(19)18-14)21-17(20)12-6-4-3-5-7-12/h3-9,15H,1-2H3,(H,18,19) |
| InChIKey | KKOBYLYVNOUNLO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |