C27H33N3O4 — CID 101025868
tert-butyl (4S)-4-(phenylmethoxycarbonylamino)-4-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]butanoate (PubChem CID 101025868) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is tert-butyl (4S)-4-(phenylmethoxycarbonylamino)-4-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]butanoate.
| Compound Name | tert-butyl (4S)-4-(phenylmethoxycarbonylamino)-4-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]butanoate |
|---|---|
| PubChem CID | 101025868 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | tert-butyl (4S)-4-(phenylmethoxycarbonylamino)-4-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]butanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)OCc1ccccc1)[C@@H]1NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C27H33N3O4/c1-27(2,3)34-23(31)14-13-22(30-26(32)33-17-18-9-5-4-6-10-18)25-24-20(15-16-28-25)19-11-7-8-12-21(19)29-24/h4-12,22,25,28-29H,13-17H2,1-3H3,(H,30,32)/t22-,25-/m0/s1 |
| InChIKey | BUMDNCCUXVEQDL-DHLKQENFSA-N |
| XLogP | 4.77 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|