C11H18NO2+ — CID 101030548
cyclopropyl 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-5-carboxylate (PubChem CID 101030548) has the molecular formula C11H18NO2+ and a molecular weight of 196.27 g/mol. Its IUPAC name is cyclopropyl 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-5-carboxylate.
| Compound Name | cyclopropyl 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 101030548 |
| Molecular Formula | C11H18NO2+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | cyclopropyl 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-5-carboxylate |
| SMILES | C[N+]1(C)CCC=C(C(=O)OC2CC2)C1 |
| InChI | InChI=1S/C11H18NO2/c1-12(2)7-3-4-9(8-12)11(13)14-10-5-6-10/h4,10H,3,5-8H2,1-2H3/q+1 |
| InChIKey | OVEFDDOAUFERTI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|