C13H23F3O4 — CID 101034855
octan-2-yl (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate (PubChem CID 101034855) has the molecular formula C13H23F3O4 and a molecular weight of 300.32 g/mol. Its IUPAC name is octan-2-yl (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate.
| Compound Name | octan-2-yl (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate |
|---|---|
| PubChem CID | 101034855 |
| Molecular Formula | C13H23F3O4 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | octan-2-yl (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate |
| SMILES | CCCCCCC(C)OC(=O)[C@H](OCOC)C(F)(F)F |
| InChI | InChI=1S/C13H23F3O4/c1-4-5-6-7-8-10(2)20-12(17)11(13(14,15)16)19-9-18-3/h10-11H,4-9H2,1-3H3/t10?,11-/m0/s1 |
| InChIKey | FKNIARIBXBJWJI-DTIOYNMSSA-N |
| XLogP | 3.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|