C15H27F3O4 — CID 15468347
decan-2-yl (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate (PubChem CID 15468347) has the molecular formula C15H27F3O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is decan-2-yl (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate.
| Compound Name | decan-2-yl (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate |
|---|---|
| PubChem CID | 15468347 |
| Molecular Formula | C15H27F3O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | decan-2-yl (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate |
| SMILES | CCCCCCCCC(C)OC(=O)[C@H](OCOC)C(F)(F)F |
| InChI | InChI=1S/C15H27F3O4/c1-4-5-6-7-8-9-10-12(2)22-14(19)13(15(16,17)18)21-11-20-3/h12-13H,4-11H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | VIXRYJAVFCUIDJ-ABLWVSNPSA-N |
| XLogP | 4.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|