C12H18N2O3S3 — CID 101047831
(3-amino-4-methoxyphenyl)sulfonyl N,N-diethylcarbamodithioate (PubChem CID 101047831) has the molecular formula C12H18N2O3S3 and a molecular weight of 334.49 g/mol. Its IUPAC name is (3-amino-4-methoxyphenyl)sulfonyl N,N-diethylcarbamodithioate.
| Compound Name | (3-amino-4-methoxyphenyl)sulfonyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 101047831 |
| Molecular Formula | C12H18N2O3S3 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (3-amino-4-methoxyphenyl)sulfonyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SS(=O)(=O)c1ccc(OC)c(N)c1 |
| InChI | InChI=1S/C12H18N2O3S3/c1-4-14(5-2)12(18)19-20(15,16)9-6-7-11(17-3)10(13)8-9/h6-8H,4-5,13H2,1-3H3 |
| InChIKey | LUBCZIWTMIKBNR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|