C9H7N3O2S — CID 10104913
1,4-dioxo-3H-phthalazine-2-carbothioamide (PubChem CID 10104913) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is 1,4-dioxo-3H-phthalazine-2-carbothioamide.
| Compound Name | 1,4-dioxo-3H-phthalazine-2-carbothioamide |
|---|---|
| PubChem CID | 10104913 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 1,4-dioxo-3H-phthalazine-2-carbothioamide |
| SMILES | NC(=S)n1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C9H7N3O2S/c10-9(15)12-8(14)6-4-2-1-3-5(6)7(13)11-12/h1-4H,(H2,10,15)(H,11,13) |
| InChIKey | IAXYECDBYDRNIO-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|