C9H16O4S — CID 101053844
[(E,4S)-4-hydroxy-3-methyl-6-oxohept-2-enyl] methanesulfinate (PubChem CID 101053844) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is [(E,4S)-4-hydroxy-3-methyl-6-oxohept-2-enyl] methanesulfinate.
| Compound Name | [(E,4S)-4-hydroxy-3-methyl-6-oxohept-2-enyl] methanesulfinate |
|---|---|
| PubChem CID | 101053844 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [(E,4S)-4-hydroxy-3-methyl-6-oxohept-2-enyl] methanesulfinate |
| SMILES | CC(=O)C[C@H](O)/C(C)=C/COS(C)=O |
| InChI | InChI=1S/C9H16O4S/c1-7(4-5-13-14(3)12)9(11)6-8(2)10/h4,9,11H,5-6H2,1-3H3/b7-4+/t9-,14?/m0/s1 |
| InChIKey | FKZMLCCCCBCDGU-KRGTZRPBSA-N |
| XLogP | 0.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|