C18H22O9 — CID 57313895
7-hydroxy-5,5-bis(3-oxobutanoyl)decane-2,4,6,9-tetrone (PubChem CID 57313895) has the molecular formula C18H22O9 and a molecular weight of 382.37 g/mol. Its IUPAC name is 7-hydroxy-5,5-bis(3-oxobutanoyl)decane-2,4,6,9-tetrone.
| Compound Name | 7-hydroxy-5,5-bis(3-oxobutanoyl)decane-2,4,6,9-tetrone |
|---|---|
| PubChem CID | 57313895 |
| Molecular Formula | C18H22O9 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 7-hydroxy-5,5-bis(3-oxobutanoyl)decane-2,4,6,9-tetrone |
| SMILES | CC(=O)CC(=O)C(C(=O)CC(C)=O)(C(=O)CC(C)=O)C(=O)C(O)CC(C)=O |
| InChI | InChI=1S/C18H22O9/c1-9(19)5-13(23)17(27)18(14(24)6-10(2)20,15(25)7-11(3)21)16(26)8-12(4)22/h13,23H,5-8H2,1-4H3 |
| InChIKey | IIZOINMGWGOWAB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 156.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|