C27H22N4S2 — CID 101057937
2-[5-[5-[(1E,3E)-4-[4-(diethylamino)phenyl]buta-1,3-dienyl]thiophen-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 101057937) has the molecular formula C27H22N4S2 and a molecular weight of 466.64 g/mol. Its IUPAC name is 2-[5-[5-[(1E,3E)-4-[4-(diethylamino)phenyl]buta-1,3-dienyl]thiophen-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[5-[5-[(1E,3E)-4-[4-(diethylamino)phenyl]buta-1,3-dienyl]thiophen-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 101057937 |
| Molecular Formula | C27H22N4S2 |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-[5-[5-[(1E,3E)-4-[4-(diethylamino)phenyl]buta-1,3-dienyl]thiophen-2-yl]thiophen-2-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | CCN(CC)c1ccc(/C=C/C=C/c2ccc(-c3ccc(C(C#N)=C(C#N)C#N)s3)s2)cc1 |
| InChI | InChI=1S/C27H22N4S2/c1-3-31(4-2)22-11-9-20(10-12-22)7-5-6-8-23-13-14-26(32-23)27-16-15-25(33-27)24(19-30)21(17-28)18-29/h5-16H,3-4H2,1-2H3/b7-5+,8-6+ |
| InChIKey | LJZQITWGRXCPNQ-KQQUZDAGSA-N |
| XLogP | 7.37 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|