C23H24N4O12S — CID 101072225
methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2E)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-3-yl]oxane-2-carboxylate (PubChem CID 101072225) has the molecular formula C23H24N4O12S and a molecular weight of 580.53 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2E)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-3-yl]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2E)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-3-yl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 101072225 |
| Molecular Formula | C23H24N4O12S |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2E)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-3-yl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](N2C(=O)CS/C2=N/N=C\c2ccc([N+](=O)[O-])cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H24N4O12S/c1-11(28)36-17-18(37-12(2)29)20(22(32)35-4)39-21(19(17)38-13(3)30)26-16(31)10-40-23(26)25-24-9-14-5-7-15(8-6-14)27(33)34/h5-9,17-21H,10H2,1-4H3/b24-9-,25-23+/t17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | XNKSKDIKISAEEA-ABKJIZCASA-N |
| XLogP | 0.55 |
| TPSA | 202.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|