C19H26O5 — CID 101072466
[(4E)-6-ethoxyhepta-4,6-dien-3-yl] 2-[(4-methoxyphenyl)methoxy]acetate (PubChem CID 101072466) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(4E)-6-ethoxyhepta-4,6-dien-3-yl] 2-[(4-methoxyphenyl)methoxy]acetate.
| Compound Name | [(4E)-6-ethoxyhepta-4,6-dien-3-yl] 2-[(4-methoxyphenyl)methoxy]acetate |
|---|---|
| PubChem CID | 101072466 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(4E)-6-ethoxyhepta-4,6-dien-3-yl] 2-[(4-methoxyphenyl)methoxy]acetate |
| SMILES | C=C(/C=C/C(CC)OC(=O)COCc1ccc(OC)cc1)OCC |
| InChI | InChI=1S/C19H26O5/c1-5-17(10-7-15(3)23-6-2)24-19(20)14-22-13-16-8-11-18(21-4)12-9-16/h7-12,17H,3,5-6,13-14H2,1-2,4H3/b10-7+ |
| InChIKey | MHJSCWKJOMZTOV-JXMROGBWSA-N |
| XLogP | 3.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|