C32H53NO7Si — CID 101081630
[(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 101081630) has the molecular formula C32H53NO7Si and a molecular weight of 591.86 g/mol. Its IUPAC name is [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 101081630 |
| Molecular Formula | C32H53NO7Si |
| Molecular Weight | 591.86 g/mol |
| Exact Mass | 591.36 |
| IUPAC Name | [(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl] (3S,4S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | C=CCOC(=O)[C@@H](OC(=O)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(C)C |
| InChI | InChI=1S/C32H53NO7Si/c1-12-18-37-31(35)30(22(4)5)39-28(34)19-27(40-41(23(6)7,24(8)9)25(10)11)29(21(2)3)33-32(36)38-20-26-16-14-13-15-17-26/h12-17,21-25,27,29-30H,1,18-20H2,2-11H3,(H,33,36)/t27-,29-,30-/m0/s1 |
| InChIKey | DJZHXBSODIVDRA-BKHJTQGXSA-N |
| XLogP | 7.19 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.86 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|