C35H48F5NO7Si — CID 101081632
[(2S)-3-methyl-1-oxo-1-(2,3,4,5,6-pentafluorophenoxy)butan-2-yl] (3S,4S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 101081632) has the molecular formula C35H48F5NO7Si and a molecular weight of 717.85 g/mol. Its IUPAC name is [(2S)-3-methyl-1-oxo-1-(2,3,4,5,6-pentafluorophenoxy)butan-2-yl] (3S,4S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | [(2S)-3-methyl-1-oxo-1-(2,3,4,5,6-pentafluorophenoxy)butan-2-yl] (3S,4S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 101081632 |
| Molecular Formula | C35H48F5NO7Si |
| Molecular Weight | 717.85 g/mol |
| Exact Mass | 717.31 |
| IUPAC Name | [(2S)-3-methyl-1-oxo-1-(2,3,4,5,6-pentafluorophenoxy)butan-2-yl] (3S,4S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | CC(C)[C@H](OC(=O)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C35H48F5NO7Si/c1-18(2)31(41-35(44)45-17-23-14-12-11-13-15-23)24(48-49(20(5)6,21(7)8)22(9)10)16-25(42)46-32(19(3)4)34(43)47-33-29(39)27(37)26(36)28(38)30(33)40/h11-15,18-22,24,31-32H,16-17H2,1-10H3,(H,41,44)/t24-,31-,32-/m0/s1 |
| InChIKey | DNOHQWKFGHYJGG-WGFGNGDISA-N |
| XLogP | 8.76 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.85 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|