C27H34F5NO5Si — CID 11444551
(2,3,4,5,6-pentafluorophenyl) (2S,3R)-3-phenylmethoxy-2-[tri(propan-2-yl)silyloxycarbonylamino]butanoate (PubChem CID 11444551) has the molecular formula C27H34F5NO5Si and a molecular weight of 575.65 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S,3R)-3-phenylmethoxy-2-[tri(propan-2-yl)silyloxycarbonylamino]butanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S,3R)-3-phenylmethoxy-2-[tri(propan-2-yl)silyloxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 11444551 |
| Molecular Formula | C27H34F5NO5Si |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S,3R)-3-phenylmethoxy-2-[tri(propan-2-yl)silyloxycarbonylamino]butanoate |
| SMILES | CC(C)[Si](OC(=O)N[C@H](C(=O)Oc1c(F)c(F)c(F)c(F)c1F)[C@@H](C)OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H34F5NO5Si/c1-14(2)39(15(3)4,16(5)6)38-27(35)33-24(17(7)36-13-18-11-9-8-10-12-18)26(34)37-25-22(31)20(29)19(28)21(30)23(25)32/h8-12,14-17,24H,13H2,1-7H3,(H,33,35)/t17-,24+/m1/s1 |
| InChIKey | QPHFNGMCHACZBE-OSPHWJPCSA-N |
| XLogP | 7.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|