C26H45NO5Si — CID 101049688
methyl (3S,4R,5S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyheptanoate (PubChem CID 101049688) has the molecular formula C26H45NO5Si and a molecular weight of 479.73 g/mol. Its IUPAC name is methyl (3S,4R,5S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyheptanoate.
| Compound Name | methyl (3S,4R,5S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyheptanoate |
|---|---|
| PubChem CID | 101049688 |
| Molecular Formula | C26H45NO5Si |
| Molecular Weight | 479.73 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | methyl (3S,4R,5S)-5-methyl-4-(phenylmethoxycarbonylamino)-3-tri(propan-2-yl)silyloxyheptanoate |
| SMILES | CC[C@H](C)[C@@H](NC(=O)OCc1ccccc1)[C@H](CC(=O)OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H45NO5Si/c1-10-21(8)25(27-26(29)31-17-22-14-12-11-13-15-22)23(16-24(28)30-9)32-33(18(2)3,19(4)5)20(6)7/h11-15,18-21,23,25H,10,16-17H2,1-9H3,(H,27,29)/t21-,23-,25+/m0/s1 |
| InChIKey | QZHNOZWNOIUISQ-UMXIMWEHSA-N |
| XLogP | 6.45 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|