C16H15N3O3 — CID 101083401
4-azido-3,4-diethoxy-2-(2-phenylethynyl)cyclobut-2-en-1-one (PubChem CID 101083401) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-azido-3,4-diethoxy-2-(2-phenylethynyl)cyclobut-2-en-1-one.
| Compound Name | 4-azido-3,4-diethoxy-2-(2-phenylethynyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 101083401 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-azido-3,4-diethoxy-2-(2-phenylethynyl)cyclobut-2-en-1-one |
| SMILES | CCOC1=C(C#Cc2ccccc2)C(=O)C1(N=[N+]=[N-])OCC |
| InChI | InChI=1S/C16H15N3O3/c1-3-21-15-13(11-10-12-8-6-5-7-9-12)14(20)16(15,18-19-17)22-4-2/h5-9H,3-4H2,1-2H3 |
| InChIKey | IMBVFLYJWPBZDJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|