C22H10N6O2 — CID 14613330
2,5-diazido-3,6-bis(2-phenylethynyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 14613330) has the molecular formula C22H10N6O2 and a molecular weight of 390.36 g/mol. Its IUPAC name is 2,5-diazido-3,6-bis(2-phenylethynyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-diazido-3,6-bis(2-phenylethynyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 14613330 |
| Molecular Formula | C22H10N6O2 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2,5-diazido-3,6-bis(2-phenylethynyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | [N-]=[N+]=NC1=C(C#Cc2ccccc2)C(=O)C(N=[N+]=[N-])=C(C#Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H10N6O2/c23-27-25-19-17(13-11-15-7-3-1-4-8-15)21(29)20(26-28-24)18(22(19)30)14-12-16-9-5-2-6-10-16/h1-10H |
| InChIKey | FMBNLOAZYCJRNH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 131.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|