C33H39P — CID 101086421
2-[3-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-1H-inden-1-yl]ethyl-diphenylphosphane (PubChem CID 101086421) has the molecular formula C33H39P and a molecular weight of 466.65 g/mol. Its IUPAC name is 2-[3-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-1H-inden-1-yl]ethyl-diphenylphosphane.
| Compound Name | 2-[3-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-1H-inden-1-yl]ethyl-diphenylphosphane |
|---|---|
| PubChem CID | 101086421 |
| Molecular Formula | C33H39P |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 2-[3-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]-1H-inden-1-yl]ethyl-diphenylphosphane |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1C1=CC(CCP(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C33H39P/c1-24(2)29-19-18-25(3)22-32(29)33-23-26(30-16-10-11-17-31(30)33)20-21-34(27-12-6-4-7-13-27)28-14-8-5-9-15-28/h4-17,23-26,29,32H,18-22H2,1-3H3/t25-,26?,29-,32-/m1/s1 |
| InChIKey | SIJMIAFLFYYAOD-USILUNSXSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|