C42H39Cl2N4O9P — CID 101087180
(2,5-dichlorophenyl) [(2R,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-pyrazin-2-ylethyl phosphate (PubChem CID 101087180) has the molecular formula C42H39Cl2N4O9P and a molecular weight of 845.67 g/mol. Its IUPAC name is (2,5-dichlorophenyl) [(2R,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-pyrazin-2-ylethyl phosphate.
| Compound Name | (2,5-dichlorophenyl) [(2R,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-pyrazin-2-ylethyl phosphate |
|---|---|
| PubChem CID | 101087180 |
| Molecular Formula | C42H39Cl2N4O9P |
| Molecular Weight | 845.67 g/mol |
| Exact Mass | 844.18 |
| IUPAC Name | (2,5-dichlorophenyl) [(2R,3S,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 2-pyrazin-2-ylethyl phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(=O)(OCCc2cnccn2)Oc2cc(Cl)ccc2Cl)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H39Cl2N4O9P/c1-28-26-48(41(50)47-40(28)49)39-24-37(57-58(51,54-22-19-33-25-45-20-21-46-33)56-36-23-32(43)15-18-35(36)44)38(55-39)27-53-42(29-9-5-3-6-10-29,30-11-7-4-8-12-30)31-13-16-34(52-2)17-14-31/h3-18,20-21,23,25-26,37-39H,19,22,24,27H2,1-2H3,(H,47,49,50)/t37-,38+,39+,58?/m0/s1 |
| InChIKey | RMEJSUVBYMGJRB-CNGLVTPWSA-N |
| XLogP | 8.08 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.67 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|