C24H33NO — CID 101102702
(3S)-2-benzyl-4-methyl-1-phenyl-3-piperidin-1-ylpentan-2-ol (PubChem CID 101102702) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is (3S)-2-benzyl-4-methyl-1-phenyl-3-piperidin-1-ylpentan-2-ol.
| Compound Name | (3S)-2-benzyl-4-methyl-1-phenyl-3-piperidin-1-ylpentan-2-ol |
|---|---|
| PubChem CID | 101102702 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | (3S)-2-benzyl-4-methyl-1-phenyl-3-piperidin-1-ylpentan-2-ol |
| SMILES | CC(C)[C@H](N1CCCCC1)C(O)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H33NO/c1-20(2)23(25-16-10-5-11-17-25)24(26,18-21-12-6-3-7-13-21)19-22-14-8-4-9-15-22/h3-4,6-9,12-15,20,23,26H,5,10-11,16-19H2,1-2H3/t23-/m0/s1 |
| InChIKey | NLJWWMGHOVXBAD-QHCPKHFHSA-N |
| XLogP | 4.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |