C27H33NO3 — CID 101106880
3-[(1R)-3-methyl-1-phenylinden-1-yl]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101106880) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 3-[(1R)-3-methyl-1-phenylinden-1-yl]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | 3-[(1R)-3-methyl-1-phenylinden-1-yl]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101106880 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 3-[(1R)-3-methyl-1-phenylinden-1-yl]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1=C[C@](CCCOC(=O)N2C(C)(C)COC2(C)C)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H33NO3/c1-20-18-27(21-12-7-6-8-13-21,23-15-10-9-14-22(20)23)16-11-17-30-24(29)28-25(2,3)19-31-26(28,4)5/h6-10,12-15,18H,11,16-17,19H2,1-5H3/t27-/m1/s1 |
| InChIKey | FNFGKFYUBKECJP-HHHXNRCGSA-N |
| XLogP | 6.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|