C25H34O6 — CID 101107734
methyl (3E,5E)-6-[(3S)-4,4-dimethyl-3-(2-methylbut-3-en-2-yloxy)-2,3-dihydro-1,5-benzodioxepin-7-yl]-4-methoxy-3-methylhexa-3,5-dienoate (PubChem CID 101107734) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is methyl (3E,5E)-6-[(3S)-4,4-dimethyl-3-(2-methylbut-3-en-2-yloxy)-2,3-dihydro-1,5-benzodioxepin-7-yl]-4-methoxy-3-methylhexa-3,5-dienoate.
| Compound Name | methyl (3E,5E)-6-[(3S)-4,4-dimethyl-3-(2-methylbut-3-en-2-yloxy)-2,3-dihydro-1,5-benzodioxepin-7-yl]-4-methoxy-3-methylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 101107734 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | methyl (3E,5E)-6-[(3S)-4,4-dimethyl-3-(2-methylbut-3-en-2-yloxy)-2,3-dihydro-1,5-benzodioxepin-7-yl]-4-methoxy-3-methylhexa-3,5-dienoate |
| SMILES | C=CC(C)(C)O[C@H]1COc2ccc(/C=C/C(OC)=C(/C)CC(=O)OC)cc2OC1(C)C |
| InChI | InChI=1S/C25H34O6/c1-9-24(3,4)31-22-16-29-20-13-11-18(15-21(20)30-25(22,5)6)10-12-19(27-7)17(2)14-23(26)28-8/h9-13,15,22H,1,14,16H2,2-8H3/b12-10+,19-17+/t22-/m0/s1 |
| InChIKey | CWQAUWCFBJCXKO-VMEFHARESA-N |
| XLogP | 5.08 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|