C27H52O3Si3 — CID 101112145
(4S,6S,7aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enyl-3-trimethylsilyl-4,5,7,7a-tetrahydro-1H-inden-2-one (PubChem CID 101112145) has the molecular formula C27H52O3Si3 and a molecular weight of 508.97 g/mol. Its IUPAC name is (4S,6S,7aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enyl-3-trimethylsilyl-4,5,7,7a-tetrahydro-1H-inden-2-one.
| Compound Name | (4S,6S,7aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enyl-3-trimethylsilyl-4,5,7,7a-tetrahydro-1H-inden-2-one |
|---|---|
| PubChem CID | 101112145 |
| Molecular Formula | C27H52O3Si3 |
| Molecular Weight | 508.97 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | (4S,6S,7aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enyl-3-trimethylsilyl-4,5,7,7a-tetrahydro-1H-inden-2-one |
| SMILES | C=CC[C@]1(O[Si](C)(C)C(C)(C)C)C[C@H]2CC(=O)C([Si](C)(C)C)=C2[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C27H52O3Si3/c1-15-16-27(30-33(13,14)26(5,6)7)18-20-17-21(28)24(31(8,9)10)23(20)22(19-27)29-32(11,12)25(2,3)4/h15,20,22H,1,16-19H2,2-14H3/t20-,22+,27+/m1/s1 |
| InChIKey | UUSIDHWOOIJAIO-YRTUYQHASA-N |
| XLogP | 8.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.97 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|