C29H34Cl2O8 — CID 101113405
bis(3-tert-butyl-5-formyl-4-hydroxyphenyl) 2,6-dichloroheptanedioate (PubChem CID 101113405) has the molecular formula C29H34Cl2O8 and a molecular weight of 581.49 g/mol. Its IUPAC name is bis(3-tert-butyl-5-formyl-4-hydroxyphenyl) 2,6-dichloroheptanedioate.
| Compound Name | bis(3-tert-butyl-5-formyl-4-hydroxyphenyl) 2,6-dichloroheptanedioate |
|---|---|
| PubChem CID | 101113405 |
| Molecular Formula | C29H34Cl2O8 |
| Molecular Weight | 581.49 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | bis(3-tert-butyl-5-formyl-4-hydroxyphenyl) 2,6-dichloroheptanedioate |
| SMILES | CC(C)(C)c1cc(OC(=O)C(Cl)CCCC(Cl)C(=O)Oc2cc(C=O)c(O)c(C(C)(C)C)c2)cc(C=O)c1O |
| InChI | InChI=1S/C29H34Cl2O8/c1-28(2,3)20-12-18(10-16(14-32)24(20)34)38-26(36)22(30)8-7-9-23(31)27(37)39-19-11-17(15-33)25(35)21(13-19)29(4,5)6/h10-15,22-23,34-35H,7-9H2,1-6H3 |
| InChIKey | INMKSGDLNMGDCG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.49 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|