C18H30N4O7 — CID 10112455
butyl (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(2R,3R,4R)-3,4-dihydroxyoxan-2-yl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 10112455) has the molecular formula C18H30N4O7 and a molecular weight of 414.46 g/mol. Its IUPAC name is butyl (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(2R,3R,4R)-3,4-dihydroxyoxan-2-yl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | butyl (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(2R,3R,4R)-3,4-dihydroxyoxan-2-yl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 10112455 |
| Molecular Formula | C18H30N4O7 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | butyl (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[(2R,3R,4R)-3,4-dihydroxyoxan-2-yl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCCCOC(=O)C1=C[C@H](N=C(N)N)[C@@H](NC(C)=O)[C@H]([C@@H]2OCC[C@@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C18H30N4O7/c1-3-4-6-28-17(26)12-8-10(22-18(19)20)13(21-9(2)23)15(29-12)16-14(25)11(24)5-7-27-16/h8,10-11,13-16,24-25H,3-7H2,1-2H3,(H,21,23)(H4,19,20,22)/t10-,11+,13+,14+,15+,16+/m0/s1 |
| InChIKey | FWUJFKQBDCJICO-QAIMWQPPSA-N |
| XLogP | -1.73 |
| TPSA | 178.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|