C12H24Cl2Si2 — CID 101125348
1,6-dichloro-1,6-disilabicyclo[4.4.4]tetradecane (PubChem CID 101125348) has the molecular formula C12H24Cl2Si2 and a molecular weight of 295.40 g/mol. Its IUPAC name is 1,6-dichloro-1,6-disilabicyclo[4.4.4]tetradecane.
| Compound Name | 1,6-dichloro-1,6-disilabicyclo[4.4.4]tetradecane |
|---|---|
| PubChem CID | 101125348 |
| Molecular Formula | C12H24Cl2Si2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1,6-dichloro-1,6-disilabicyclo[4.4.4]tetradecane |
| SMILES | Cl[Si]12CCCC[Si](Cl)(CCCC1)CCCC2 |
| InChI | InChI=1S/C12H24Cl2Si2/c13-15-7-1-2-8-16(14,11-5-3-9-15)12-6-4-10-15/h1-12H2 |
| InChIKey | GPSFRLBDUXWCBB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|