C12H13NOS — CID 101125906
(5S)-2-benzylsulfanyl-5-ethenyl-4,5-dihydro-1,3-oxazole (PubChem CID 101125906) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is (5S)-2-benzylsulfanyl-5-ethenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (5S)-2-benzylsulfanyl-5-ethenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 101125906 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (5S)-2-benzylsulfanyl-5-ethenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C=C[C@H]1CN=C(SCc2ccccc2)O1 |
| InChI | InChI=1S/C12H13NOS/c1-2-11-8-13-12(14-11)15-9-10-6-4-3-5-7-10/h2-7,11H,1,8-9H2/t11-/m0/s1 |
| InChIKey | MQRNIGOQVMISHN-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|