C20H40Si — CID 101127399
[(6E)-3,6-dimethyldodeca-1,6-dien-3-yl]-triethylsilane (PubChem CID 101127399) has the molecular formula C20H40Si and a molecular weight of 308.63 g/mol. Its IUPAC name is [(6E)-3,6-dimethyldodeca-1,6-dien-3-yl]-triethylsilane.
| Compound Name | [(6E)-3,6-dimethyldodeca-1,6-dien-3-yl]-triethylsilane |
|---|---|
| PubChem CID | 101127399 |
| Molecular Formula | C20H40Si |
| Molecular Weight | 308.63 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | [(6E)-3,6-dimethyldodeca-1,6-dien-3-yl]-triethylsilane |
| SMILES | C=CC(C)(CC/C(C)=C/CCCCC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H40Si/c1-8-13-14-15-16-19(6)17-18-20(7,9-2)21(10-3,11-4)12-5/h9,16H,2,8,10-15,17-18H2,1,3-7H3/b19-16+ |
| InChIKey | ATNWLWKHBNSDPX-KNTRCKAVSA-N |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.63 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|