C16H20O5 — CID 101129066
8-methylidene-2,5,9,12-tetraoxabicyclo[13.4.0]nonadeca-1(19),15,17-trien-7-one (PubChem CID 101129066) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 8-methylidene-2,5,9,12-tetraoxabicyclo[13.4.0]nonadeca-1(19),15,17-trien-7-one.
| Compound Name | 8-methylidene-2,5,9,12-tetraoxabicyclo[13.4.0]nonadeca-1(19),15,17-trien-7-one |
|---|---|
| PubChem CID | 101129066 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 8-methylidene-2,5,9,12-tetraoxabicyclo[13.4.0]nonadeca-1(19),15,17-trien-7-one |
| SMILES | C=C1OCCOCCc2ccccc2OCCOCC1=O |
| InChI | InChI=1S/C16H20O5/c1-13-15(17)12-19-9-11-21-16-5-3-2-4-14(16)6-7-18-8-10-20-13/h2-5H,1,6-12H2 |
| InChIKey | VKXDQWXNZYVZPJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|