C12H14O — CID 10631068
3-methylidene-5,6-dihydro-4H-1-benzoxocine (PubChem CID 10631068) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-methylidene-5,6-dihydro-4H-1-benzoxocine.
| Compound Name | 3-methylidene-5,6-dihydro-4H-1-benzoxocine |
|---|---|
| PubChem CID | 10631068 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 3-methylidene-5,6-dihydro-4H-1-benzoxocine |
| SMILES | C=C1CCCc2ccccc2OC1 |
| InChI | InChI=1S/C12H14O/c1-10-5-4-7-11-6-2-3-8-12(11)13-9-10/h2-3,6,8H,1,4-5,7,9H2 |
| InChIKey | HQGMQLIXAOTYTK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|