C9H7NO — CID 101132235
4,5,6,7-tetradeuterio-1H-indole-3-carbaldehyde (PubChem CID 101132235) has the molecular formula C9H7NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 4,5,6,7-tetradeuterio-1H-indole-3-carbaldehyde.
| Compound Name | 4,5,6,7-tetradeuterio-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 101132235 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 4,5,6,7-tetradeuterio-1H-indole-3-carbaldehyde |
| SMILES | [2H]c1c([2H])c([2H])c2c(C=O)c[nH]c2c1[2H] |
| InChI | InChI=1S/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H/i1D,2D,3D,4D |
| InChIKey | OLNJUISKUQQNIM-RHQRLBAQSA-N |
| XLogP | 1.98 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|