C7H6O2 — CID 162704737
2,3,4,5-tetradeuterio-6-deuteriooxybenzaldehyde (PubChem CID 162704737) has the molecular formula C7H6O2 and a molecular weight of 127.15 g/mol. Its IUPAC name is 2,3,4,5-tetradeuterio-6-deuteriooxybenzaldehyde.
| Compound Name | 2,3,4,5-tetradeuterio-6-deuteriooxybenzaldehyde |
|---|---|
| PubChem CID | 162704737 |
| Molecular Formula | C7H6O2 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-deuteriooxybenzaldehyde |
| SMILES | [2H]Oc1c([2H])c([2H])c([2H])c([2H])c1C=O |
| InChI | InChI=1S/C7H6O2/c8-5-6-3-1-2-4-7(6)9/h1-5,9H/i1D,2D,3D,4D/hD |
| InChIKey | SMQUZDBALVYZAC-HXRFYODMSA-N |
| XLogP | 1.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|