C19H29NO10 — CID 10113576
methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-methylpentanoylamino)oxane-2-carboxylate (PubChem CID 10113576) has the molecular formula C19H29NO10 and a molecular weight of 431.44 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-methylpentanoylamino)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-methylpentanoylamino)oxane-2-carboxylate |
|---|---|
| PubChem CID | 10113576 |
| Molecular Formula | C19H29NO10 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-methylpentanoylamino)oxane-2-carboxylate |
| SMILES | CCCC(C)C(=O)N[C@@H]1O[C@H](C(=O)OC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H29NO10/c1-7-8-9(2)17(24)20-18-15(29-12(5)23)13(27-10(3)21)14(28-11(4)22)16(30-18)19(25)26-6/h9,13-16,18H,7-8H2,1-6H3,(H,20,24)/t9?,13-,14-,15+,16-,18+/m0/s1 |
| InChIKey | GAKUETRVLXCZGW-KTAAIDHSSA-N |
| XLogP | 0.23 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|