C17H19NO2 — CID 101139844
(3R,4S)-8-methoxy-5-methyl-4-phenyl-1,2,3,4-tetrahydroquinolin-3-ol (PubChem CID 101139844) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (3R,4S)-8-methoxy-5-methyl-4-phenyl-1,2,3,4-tetrahydroquinolin-3-ol.
| Compound Name | (3R,4S)-8-methoxy-5-methyl-4-phenyl-1,2,3,4-tetrahydroquinolin-3-ol |
|---|---|
| PubChem CID | 101139844 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (3R,4S)-8-methoxy-5-methyl-4-phenyl-1,2,3,4-tetrahydroquinolin-3-ol |
| SMILES | COc1ccc(C)c2c1NC[C@H](O)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-11-8-9-14(20-2)17-15(11)16(13(19)10-18-17)12-6-4-3-5-7-12/h3-9,13,16,18-19H,10H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | SVLOENRLCGVJLG-XJKSGUPXSA-N |
| XLogP | 2.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |