C24H24F6N4 — CID 101142711
2-(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)-1,1-bis[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]hydrazine (PubChem CID 101142711) has the molecular formula C24H24F6N4 and a molecular weight of 482.47 g/mol. Its IUPAC name is 2-(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)-1,1-bis[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]hydrazine.
| Compound Name | 2-(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)-1,1-bis[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]hydrazine |
|---|---|
| PubChem CID | 101142711 |
| Molecular Formula | C24H24F6N4 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 2-(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)-1,1-bis[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]hydrazine |
| SMILES | CC1(C)CN=C(NN(/C=C/c2ccc(C(F)(F)F)cc2)/C=C/c2ccc(C(F)(F)F)cc2)NC1 |
| InChI | InChI=1S/C24H24F6N4/c1-22(2)15-31-21(32-16-22)33-34(13-11-17-3-7-19(8-4-17)23(25,26)27)14-12-18-5-9-20(10-6-18)24(28,29)30/h3-14H,15-16H2,1-2H3,(H2,31,32,33)/b13-11+,14-12+ |
| InChIKey | ZEUXDKQFFZKKPG-PHEQNACWSA-N |
| XLogP | 6.16 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|