C27H26F6N4O — CID 173442464
1-[2-[2-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]hydrazinyl]-5,5-dimethyl-4,6-dihydropyrimidin-1-yl]ethanone (PubChem CID 173442464) has the molecular formula C27H26F6N4O and a molecular weight of 536.52 g/mol. Its IUPAC name is 1-[2-[2-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]hydrazinyl]-5,5-dimethyl-4,6-dihydropyrimidin-1-yl]ethanone.
| Compound Name | 1-[2-[2-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]hydrazinyl]-5,5-dimethyl-4,6-dihydropyrimidin-1-yl]ethanone |
|---|---|
| PubChem CID | 173442464 |
| Molecular Formula | C27H26F6N4O |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 1-[2-[2-[1,5-bis[4-(trifluoromethyl)phenyl]penta-1,4-dien-3-ylidene]hydrazinyl]-5,5-dimethyl-4,6-dihydropyrimidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(C)(C)CN=C1NN=C(C=Cc1ccc(C(F)(F)F)cc1)C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H26F6N4O/c1-18(38)37-17-25(2,3)16-34-24(37)36-35-23(14-8-19-4-10-21(11-5-19)26(28,29)30)15-9-20-6-12-22(13-7-20)27(31,32)33/h4-15H,16-17H2,1-3H3,(H,34,36) |
| InChIKey | VPBSXGNTPARAEP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|