C19H15N5 — CID 101149623
(2-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-6-yl)-phenyldiazene (PubChem CID 101149623) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is (2-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-6-yl)-phenyldiazene.
| Compound Name | (2-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-6-yl)-phenyldiazene |
|---|---|
| PubChem CID | 101149623 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2-methyl-7-phenylpyrazolo[1,5-a]pyrimidin-6-yl)-phenyldiazene |
| SMILES | Cc1cc2ncc(/N=N/c3ccccc3)c(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C19H15N5/c1-14-12-18-20-13-17(22-21-16-10-6-3-7-11-16)19(24(18)23-14)15-8-4-2-5-9-15/h2-13H,1H3/b22-21+ |
| InChIKey | XXJKXCRCUCSBJE-QURGRASLSA-N |
| XLogP | 5.12 |
| TPSA | 54.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|