C52H59ClN2O6 — CID 101153436
[4-chloro-3-[4-[(2-methyl-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(2-methyl-4-octoxyphenyl)iminomethyl]benzoate (PubChem CID 101153436) has the molecular formula C52H59ClN2O6 and a molecular weight of 843.51 g/mol. Its IUPAC name is [4-chloro-3-[4-[(2-methyl-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(2-methyl-4-octoxyphenyl)iminomethyl]benzoate.
| Compound Name | [4-chloro-3-[4-[(2-methyl-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(2-methyl-4-octoxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 101153436 |
| Molecular Formula | C52H59ClN2O6 |
| Molecular Weight | 843.51 g/mol |
| Exact Mass | 842.41 |
| IUPAC Name | [4-chloro-3-[4-[(2-methyl-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(2-methyl-4-octoxyphenyl)iminomethyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(/N=C/c2ccc(C(=O)Oc3ccc(Cl)c(OC(=O)c4ccc(/C=N/c5ccc(OCCCCCCCC)cc5C)cc4)c3)cc2)c(C)c1 |
| InChI | InChI=1S/C52H59ClN2O6/c1-5-7-9-11-13-15-31-58-44-26-29-48(38(3)33-44)54-36-40-17-21-42(22-18-40)51(56)60-46-25-28-47(53)50(35-46)61-52(57)43-23-19-41(20-24-43)37-55-49-30-27-45(34-39(49)4)59-32-16-14-12-10-8-6-2/h17-30,33-37H,5-16,31-32H2,1-4H3/b54-36+,55-37+ |
| InChIKey | PTQYWGXPWYCGDQ-OTAUUECISA-N |
| XLogP | 14.38 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.51 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|