C22H27NO3 — CID 43836049
4-[(4-heptoxy-2-methylphenyl)iminomethyl]benzoic acid (PubChem CID 43836049) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-[(4-heptoxy-2-methylphenyl)iminomethyl]benzoic acid.
| Compound Name | 4-[(4-heptoxy-2-methylphenyl)iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 43836049 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-[(4-heptoxy-2-methylphenyl)iminomethyl]benzoic acid |
| SMILES | CCCCCCCOc1ccc(/N=C/c2ccc(C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C22H27NO3/c1-3-4-5-6-7-14-26-20-12-13-21(17(2)15-20)23-16-18-8-10-19(11-9-18)22(24)25/h8-13,15-16H,3-7,14H2,1-2H3,(H,24,25)/b23-16+ |
| InChIKey | VAOCDWZFPWKOPF-XQNSMLJCSA-N |
| XLogP | 5.79 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|