C34H49N7O11S — CID 101159855
benzyl N-[4-[[2-[5-[[(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]amino]pentylamino]-2-oxoethyl]-(4-nitrophenyl)sulfonylamino]butyl]carbamate (PubChem CID 101159855) has the molecular formula C34H49N7O11S and a molecular weight of 763.87 g/mol. Its IUPAC name is benzyl N-[4-[[2-[5-[[(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]amino]pentylamino]-2-oxoethyl]-(4-nitrophenyl)sulfonylamino]butyl]carbamate.
| Compound Name | benzyl N-[4-[[2-[5-[[(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]amino]pentylamino]-2-oxoethyl]-(4-nitrophenyl)sulfonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 101159855 |
| Molecular Formula | C34H49N7O11S |
| Molecular Weight | 763.87 g/mol |
| Exact Mass | 763.32 |
| IUPAC Name | benzyl N-[4-[[2-[5-[[(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]amino]pentylamino]-2-oxoethyl]-(4-nitrophenyl)sulfonylamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(N)=O)C(=O)NCCCCCNC(=O)CN(CCCCNC(=O)OCc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H49N7O11S/c1-34(2,3)52-33(46)39-28(22-29(35)42)31(44)37-19-9-5-8-18-36-30(43)23-40(53(49,50)27-16-14-26(15-17-27)41(47)48)21-11-10-20-38-32(45)51-24-25-12-6-4-7-13-25/h4,6-7,12-17,28H,5,8-11,18-24H2,1-3H3,(H2,35,42)(H,36,43)(H,37,44)(H,38,45)(H,39,46)/t28-/m0/s1 |
| InChIKey | MOZSRILZEHUWSA-NDEPHWFRSA-N |
| XLogP | 2.46 |
| TPSA | 258.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|