C26H26F4OS3 — CID 101166119
[6-ethoxy-3,3,4,4-tetrafluoro-1,1-bis(phenylsulfanyl)hexyl]sulfanylbenzene (PubChem CID 101166119) has the molecular formula C26H26F4OS3 and a molecular weight of 526.69 g/mol. Its IUPAC name is [6-ethoxy-3,3,4,4-tetrafluoro-1,1-bis(phenylsulfanyl)hexyl]sulfanylbenzene.
| Compound Name | [6-ethoxy-3,3,4,4-tetrafluoro-1,1-bis(phenylsulfanyl)hexyl]sulfanylbenzene |
|---|---|
| PubChem CID | 101166119 |
| Molecular Formula | C26H26F4OS3 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | [6-ethoxy-3,3,4,4-tetrafluoro-1,1-bis(phenylsulfanyl)hexyl]sulfanylbenzene |
| SMILES | CCOCCC(F)(F)C(F)(F)CC(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C26H26F4OS3/c1-2-31-19-18-24(27,28)25(29,30)20-26(32-21-12-6-3-7-13-21,33-22-14-8-4-9-15-22)34-23-16-10-5-11-17-23/h3-17H,2,18-20H2,1H3 |
| InChIKey | QXCKHTIHPRPAIA-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|