C25H27F4OS+ — CID 157121964
5,5,6,6-tetrafluoroheptan-1-ol;triphenylsulfanium (PubChem CID 157121964) has the molecular formula C25H27F4OS+ and a molecular weight of 451.55 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoroheptan-1-ol;triphenylsulfanium.
| Compound Name | 5,5,6,6-tetrafluoroheptan-1-ol;triphenylsulfanium |
|---|---|
| PubChem CID | 157121964 |
| Molecular Formula | C25H27F4OS+ |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 5,5,6,6-tetrafluoroheptan-1-ol;triphenylsulfanium |
| SMILES | CC(F)(F)C(F)(F)CCCCO.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C7H12F4O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6(8,9)7(10,11)4-2-3-5-12/h1-15H;12H,2-5H2,1H3/q+1; |
| InChIKey | AIBOTJALASAULZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|