C23H23F4O4S2+ — CID 87256507
1,1,2,2-tetrafluoro-5-hydroxypentane-1-sulfonic acid;triphenylsulfanium (PubChem CID 87256507) has the molecular formula C23H23F4O4S2+ and a molecular weight of 503.56 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-5-hydroxypentane-1-sulfonic acid;triphenylsulfanium.
| Compound Name | 1,1,2,2-tetrafluoro-5-hydroxypentane-1-sulfonic acid;triphenylsulfanium |
|---|---|
| PubChem CID | 87256507 |
| Molecular Formula | C23H23F4O4S2+ |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 1,1,2,2-tetrafluoro-5-hydroxypentane-1-sulfonic acid;triphenylsulfanium |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)CCCO.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C5H8F4O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-4(7,2-1-3-10)5(8,9)14(11,12)13/h1-15H;10H,1-3H2,(H,11,12,13)/q+1; |
| InChIKey | LUIOCCKLOFDVIP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|