C24H25F4O4S2+ — CID 123878744
[hydroxy-oxo-(1,1,2,2-tetrafluoro-6-hydroxyhexyl)-λ6-sulfanylidene]-(triphenyl-λ4-sulfanyl)oxidanium (PubChem CID 123878744) has the molecular formula C24H25F4O4S2+ and a molecular weight of 517.59 g/mol. Its IUPAC name is [hydroxy-oxo-(1,1,2,2-tetrafluoro-6-hydroxyhexyl)-λ6-sulfanylidene]-(triphenyl-λ4-sulfanyl)oxidanium.
| Compound Name | [hydroxy-oxo-(1,1,2,2-tetrafluoro-6-hydroxyhexyl)-λ6-sulfanylidene]-(triphenyl-λ4-sulfanyl)oxidanium |
|---|---|
| PubChem CID | 123878744 |
| Molecular Formula | C24H25F4O4S2+ |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | [hydroxy-oxo-(1,1,2,2-tetrafluoro-6-hydroxyhexyl)-λ6-sulfanylidene]-(triphenyl-λ4-sulfanyl)oxidanium |
| SMILES | O=S(O)(=[O+]S(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)CCCCO |
| InChI | InChI=1S/C24H24F4O4S2/c25-23(26,18-10-11-19-29)24(27,28)34(30,31)32-33(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-9,12-17,29H,10-11,18-19H2/p+1 |
| InChIKey | CYTXFNBPIZRDGF-UHFFFAOYSA-O |
| XLogP | 6.91 |
| TPSA | 68.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|