C23H23F4O4S2+ — CID 123803953
[hydroxy-oxo-(1,1,2,2-tetrafluoro-5-hydroxypentyl)-λ6-sulfanylidene]-(triphenyl-λ4-sulfanyl)oxidanium (PubChem CID 123803953) has the molecular formula C23H23F4O4S2+ and a molecular weight of 503.56 g/mol. Its IUPAC name is [hydroxy-oxo-(1,1,2,2-tetrafluoro-5-hydroxypentyl)-λ6-sulfanylidene]-(triphenyl-λ4-sulfanyl)oxidanium.
| Compound Name | [hydroxy-oxo-(1,1,2,2-tetrafluoro-5-hydroxypentyl)-λ6-sulfanylidene]-(triphenyl-λ4-sulfanyl)oxidanium |
|---|---|
| PubChem CID | 123803953 |
| Molecular Formula | C23H23F4O4S2+ |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | [hydroxy-oxo-(1,1,2,2-tetrafluoro-5-hydroxypentyl)-λ6-sulfanylidene]-(triphenyl-λ4-sulfanyl)oxidanium |
| SMILES | O=S(O)(=[O+]S(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)CCCO |
| InChI | InChI=1S/C23H22F4O4S2/c24-22(25,17-10-18-28)23(26,27)33(29,30)31-32(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1-9,11-16,28H,10,17-18H2/p+1 |
| InChIKey | PCHQVFVLHASUDA-UHFFFAOYSA-O |
| XLogP | 6.52 |
| TPSA | 68.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|