C13H22O3 — CID 101186067
4,4-dimethylundecane-2,6,10-trione (PubChem CID 101186067) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4,4-dimethylundecane-2,6,10-trione.
| Compound Name | 4,4-dimethylundecane-2,6,10-trione |
|---|---|
| PubChem CID | 101186067 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 4,4-dimethylundecane-2,6,10-trione |
| SMILES | CC(=O)CCCC(=O)CC(C)(C)CC(C)=O |
| InChI | InChI=1S/C13H22O3/c1-10(14)6-5-7-12(16)9-13(3,4)8-11(2)15/h5-9H2,1-4H3 |
| InChIKey | CIAAXRBVUNMKGN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |